| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:49 UTC |
|---|
| Update Date | 2025-03-25 00:51:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02187250 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H13FN2O3 |
|---|
| Molecular Mass | 288.091 |
|---|
| SMILES | CC(=O)Nc1ccc(Oc2ccc(F)cc2C(N)=O)cc1 |
|---|
| InChI Key | ACPVAMKPODCPTA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 3-halobenzoic acids and derivativesacetamidesacetanilidesaryl fluoridesbenzamidesbenzoyl derivativescarbonyl compoundscarboxylic acids and derivativesdiarylethersfluorobenzeneshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganofluoridesorganopnictogen compoundsphenol ethersphenoxy compoundsprimary carboxylic acid amidessecondary carboxylic acid amides |
|---|
| Substituents | aryl fluorideprimary carboxylic acid amidediaryl etherphenol ethercarbonyl groupethern-acetylarylamine3-halobenzoic acid or derivativesbenzoyln-arylamidecarboxylic acid derivativeorganohalogen compoundbenzamidefluorobenzeneorganic oxideorganonitrogen compoundorganopnictogen compoundacetamideacetanilideorganofluoridebenzoic acid or derivativeshalobenzoic acid or derivativescarboxamide grouparyl halidearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|
