| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:55 UTC |
|---|
| Update Date | 2025-03-25 00:51:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02187477 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H30N2O2 |
|---|
| Molecular Mass | 342.2307 |
|---|
| SMILES | CC(C)C=CCCCCC(=O)N1CCN(C(=O)c2ccccc2)CC1 |
|---|
| InChI Key | SMYCONJVIYUHNT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzoyl derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperazinestertiary carboxylic acid amides |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundazacyclebenzoylcarboxamide groupcarboxylic acid derivativebenzamideorganic oxideorganic oxygen compoundpiperazine1,4-diazinanetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
