| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:53:57 UTC |
|---|
| Update Date | 2025-03-25 00:51:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02187560 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16O3S |
|---|
| Molecular Mass | 228.082 |
|---|
| SMILES | CC(C)(O)Cc1ccc(CS(=O)O)cc1 |
|---|
| InChI Key | QXDYMIKZXBXXOQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpropanes |
|---|
| Direct Parent | phenylpropanes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkanesulfinic acids and derivativeshydrocarbon derivativesorganic oxidesorganosulfur compoundssulfinic acidstertiary alcohols |
|---|
| Substituents | alcoholsulfinic acid derivativeorganosulfur compoundsulfinic acidphenylpropanearomatic homomonocyclic compoundalkanesulfinic acid or derivativestertiary alcoholorganic oxideorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|
