Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:53:58 UTC |
---|
Update Date | 2025-03-25 00:51:32 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02187597 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C11H15NO5S |
---|
Molecular Mass | 273.0671 |
---|
SMILES | CC(C)(CC(=O)OS(=O)(=O)O)c1ccccc1N |
---|
InChI Key | BBSUEVYSHVRGIY-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | phenylpropanes |
---|
Direct Parent | phenylpropanes |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | amino acids and derivativescarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsprimary aminessulfuric acid monoesters |
---|
Substituents | sulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivativesamino acid or derivativescarboxylic acid derivativephenylpropanearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundsulfuric acid esteramineorganooxygen compound |
---|