Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:54:00 UTC |
---|
Update Date | 2025-03-25 00:51:32 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02187644 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C11H12ClNO3 |
---|
Molecular Mass | 241.0506 |
---|
SMILES | CC(C)C(=O)Nc1ccc(Cl)cc1C(=O)O |
---|
InChI Key | OEVILGFILDPPFV-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | acylaminobenzoic acid and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-carboxy-2-haloaromatic compounds3-halobenzoic acidsanilidesaryl chloridesbenzoic acidsbenzoyl derivativescarbonyl compoundschlorobenzeneshalobenzoic acidshydrocarbon derivativesmonocarboxylic acids and derivativesn-arylamidesorganic oxidesorganochloridesorganopnictogen compoundssecondary carboxylic acid amidesvinylogous amides |
---|
Substituents | carbonyl groupcarboxylic acid3-halobenzoic acid or derivativesorganochloridebenzoyln-arylamidecarboxylic acid derivativeorganohalogen compoundorganic oxide3-halobenzoic acidorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidaryl chloridechlorobenzenevinylogous amidehalobenzoic acidacylaminobenzoic acid or derivativeshalobenzoic acid or derivativescarboxamide grouparyl halidearomatic homomonocyclic compoundanilidesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
---|