| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:01 UTC |
|---|
| Update Date | 2025-03-25 00:51:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02187689 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H21O11P |
|---|
| Molecular Mass | 360.0821 |
|---|
| SMILES | CC(C)C(=O)OC1C(O)C(COP(=O)(O)O)OC(O)(CO)C1O |
|---|
| InChI Key | XEZJOLGVAHXTSI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estershemiacetalshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatecarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholhexose phosphatehemiacetalhydrocarbon derivativeoxaneorganic phosphoric acid derivativealkyl phosphateorganoheterocyclic compound |
|---|
