| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:08 UTC |
|---|
| Update Date | 2025-03-25 00:51:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02187961 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H22ClN5OS |
|---|
| Molecular Mass | 355.1234 |
|---|
| SMILES | CC(=O)NCCCCCNC(=S)NC(=N)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | RIHDTGGNDYQUSF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | chlorobenzenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesaryl chloridescarbonyl compoundscarboximidamidescarboxylic acids and derivativesguanidineshydrocarbon derivativesiminesorganic oxidesorganochloridesorganopnictogen compoundssecondary carboxylic acid amidesthioureas |
|---|
| Substituents | carbonyl groupthioureaguanidineimineorganochlorideorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidearyl chloridechlorobenzenecarboximidamidecarboxamide grouparyl halidearomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
