Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:54:09 UTC |
---|
Update Date | 2025-03-25 00:51:35 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02187982 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C10H10ClNO3 |
---|
Molecular Mass | 227.0349 |
---|
SMILES | CC(=O)NCC(=O)Oc1ccc(Cl)cc1 |
---|
InChI Key | YOZGBUCLJWENKU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | acyl glycines |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | acetamidesalpha amino acid estersalpha amino acidsaryl chloridescarbonyl compoundscarboxylic acid esterschlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsphenol estersphenoxy compoundssecondary carboxylic acid amides |
---|
Substituents | monocyclic benzene moietycarbonyl grouporganochlorideorganohalogen compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundacetamidearyl chloridechlorobenzenealpha-amino acid estercarboxamide groupn-acylglycinearyl halidearomatic homomonocyclic compoundsecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterphenol esterhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzenephenoxy compoundorganooxygen compound |
---|