| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:10 UTC |
|---|
| Update Date | 2025-03-25 00:51:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02188023 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H13NO3 |
|---|
| Molecular Mass | 267.0895 |
|---|
| SMILES | CC(=O)Nc1cc2c(ccc3cc(O)ccc32)cc1O |
|---|
| InChI Key | IAMQDRNNQBMYFV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrols |
|---|
| Direct Parent | phenanthrols |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetamidescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesnaphthols and derivativesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupn-acetylarylaminephenanthrol1-hydroxy-2-unsubstituted benzenoidn-arylamidearomatic homopolycyclic compoundcarboxamide groupcarboxylic acid derivativesecondary carboxylic acid amideorganic oxidenaphthaleneorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compound2-naphtholacetamideorganooxygen compound |
|---|
