Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:54:11 UTC |
---|
Update Date | 2025-03-25 00:51:36 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02188055 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C15H17NO10 |
---|
Molecular Mass | 371.0852 |
---|
SMILES | CC(=O)Nc1ccc(OC2C(C(=O)O)OC(O)(C(=O)O)C(O)C2O)cc1 |
---|
InChI Key | BHGNIKFAWRFBSU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | glucuronic acid derivatives |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1,2-diolsacetamidesacetanilidesalkyl aryl ethersalpha hydroxy acids and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesn-acetylarylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidglucuronic acid or derivativesn-acetylarylaminearomatic heteromonocyclic compoundalpha-hydroxy acidmonosacchariden-arylamidealkyl aryl ethercarboxylic acid derivativepyran carboxylic acidbeta-hydroxy acidorganic oxideorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compoundacetamide1,2-diolalcoholpyran carboxylic acid or derivativesacetanilidehydroxy acidcarboxamide groupanilideoxacyclesecondary carboxylic acid amidepyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compound |
---|