| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:11 UTC |
|---|
| Update Date | 2025-03-25 00:51:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02188057 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19NO7 |
|---|
| Molecular Mass | 313.1162 |
|---|
| SMILES | CC(=O)Nc1ccc(OCC2OC(O)(CO)C(O)C2O)cc1 |
|---|
| InChI Key | FAHLKJHJALEEBY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl etherscarbonyl compoundscarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesn-acetylarylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenol ethersphenoxy compoundssecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | phenol ethercarbonyl groupethern-acetylarylaminearomatic heteromonocyclic compoundmonosacchariden-arylamidealkyl aryl ethercarboxylic acid derivativesaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundhemiacetalorganoheterocyclic compoundacetamidealcoholacetanilidetetrahydrofurancarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
