| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:11 UTC |
|---|
| Update Date | 2025-03-25 00:51:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02188059 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H15NO7 |
|---|
| Molecular Mass | 309.0849 |
|---|
| SMILES | CC(=O)Nc1ccc(OC2OC(C(=O)O)CC2C(=O)O)cc1 |
|---|
| InChI Key | XGPXFZZLJISLLB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenol ethersphenoxy compoundssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acidn-acetylarylaminearomatic heteromonocyclic compoundn-arylamidecarboxylic acid derivativeorganic oxideacetalorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundacetamideacetanilidetetrahydrofurancarboxamide groupoxacyclesecondary carboxylic acid amideorganic oxygen compounddicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
