| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:11 UTC |
|---|
| Update Date | 2025-03-25 00:51:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02188065 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H25N3O4 |
|---|
| Molecular Mass | 335.1845 |
|---|
| SMILES | CC(=O)Nc1ccc(C(=O)N2CCN(CCOCCO)CC2)cc1 |
|---|
| InChI Key | TUFDPHDRBZWALT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | acylaminobenzoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesalcohols and polyolsamino acids and derivativesazacyclic compoundsbenzamidesbenzoyl derivativescarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesn-acetylarylaminesn-alkylpiperazinesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidestertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | carbonyl groupethern-acetylarylaminearomatic heteromonocyclic compoundamino acid or derivativesbenzoyln-arylamidecarboxylic acid derivativedialkyl etherbenzamideorganic oxidepiperazinetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundtertiary amineorganoheterocyclic compoundacetamidealcoholacylaminobenzoic acid or derivativesazacycleacetaniliden-alkylpiperazinetertiary aliphatic aminecarboxamide groupanilidesecondary carboxylic acid amideorganic oxygen compound1,4-diazinanehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
