| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:13 UTC |
|---|
| Update Date | 2025-03-25 00:51:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02188115 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H16N2O3 |
|---|
| Molecular Mass | 320.1161 |
|---|
| SMILES | CC(=O)NCCc1c[nH]c2cc3oc(=O)c4ccccc4c3cc12 |
|---|
| InChI Key | LRMVIGSTTRCMQN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans2-benzopyransacetamidesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesindolesisocoumarins and derivativeslactonesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspyranones and derivativespyrrolessecondary carboxylic acid amides |
|---|
| Substituents | carbonyl group1-benzopyranindolecarboxylic acid derivativelactoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundpyranoneorganopnictogen compoundorganoheterocyclic compoundacetamidebenzopyranazacycleheteroaromatic compoundindole or derivativescarboxamide groupisocoumarincoumarinoxacyclesecondary carboxylic acid amideorganic oxygen compoundpyranpyrrole2-benzopyranhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
