| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:19 UTC |
|---|
| Update Date | 2025-03-25 00:51:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02188339 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H10NO7P |
|---|
| Molecular Mass | 227.0195 |
|---|
| SMILES | CC(NP(=O)(O)OCC(=O)O)C(=O)O |
|---|
| InChI Key | YXJRMFUGNCVTFK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alanine and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganic phosphoramidesorganonitrogen compoundsorganopnictogen compoundsphosphate estersphosphoric monoester monoamides |
|---|
| Substituents | phosphoric monoester monoamidealiphatic acyclic compoundcarbonyl groupcarboxylic acidorganic oxideorganic oxygen compoundphosphoric acid esterorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundalanine or derivativeshydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativeorganic phosphoric acid amideorganooxygen compound |
|---|
