| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:21 UTC |
|---|
| Update Date | 2025-03-25 00:51:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02188449 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H27N2O9+ |
|---|
| Molecular Mass | 415.1711 |
|---|
| SMILES | CC(Cc1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)c([N+](=O)[O-])c1)[N+](C)(C)C |
|---|
| InChI Key | OYJGWMBJBLPJFB-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsaminesamphetamines and derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesnitroaromatic compoundsnitrobenzenesorganic cationsorganic oxidesorganic oxoanionic compoundsorganic oxoazanium compoundsorganic saltsorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundsphenylpropanespyran carboxylic acidssecondary alcoholstetraalkylammonium salts |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundo-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidorganic nitro compoundphenylpropane1-o-glucuronidebeta-hydroxy acidorganic oxideacetalc-nitro compoundorganonitrogen compoundorganopnictogen compoundorganic cationorganic oxoazaniumoxaneorganic saltamphetamine or derivativesorganoheterocyclic compoundnitrobenzenenitroaromatic compoundalcoholpyran carboxylic acid or derivativestetraalkylammonium saltquaternary ammonium salthydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundamineorganic hyponitrite |
|---|