| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:23 UTC |
|---|
| Update Date | 2025-03-25 00:51:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02188526 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H17O10P |
|---|
| Molecular Mass | 316.0559 |
|---|
| SMILES | CC(COP(=O)(O)OCC(O)C(O)C(O)C=O)C(=O)O |
|---|
| InChI Key | LFHAFDYTMPLXNX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxyaldehydesbeta-hydroxy aldehydescarboxylic acidsdialkyl phosphateshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundbeta-hydroxy aldehydecarbonyl groupcarboxylic acidpentose phosphatealdehydecarboxylic acid derivativedialkyl phosphateorganic oxidemonocarboxylic acid or derivativesalpha-hydroxyaldehydephosphoric acid estersecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
