| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:30 UTC |
|---|
| Update Date | 2025-03-25 00:51:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02188763 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H34O |
|---|
| Molecular Mass | 326.261 |
|---|
| SMILES | CC1(C)C(=O)C=CC2(C)C3=C(CCC12)C1CCC(C)(C)C1(C)CC3 |
|---|
| InChI Key | AXWFZTMFQBCNCQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | androstane steroids |
|---|
| Direct Parent | androgens and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 3-oxo delta-1-steroidscyclohexenonesdelta-1-steroidsditerpenoidshydrocarbon derivativesorganic oxides |
|---|
| Substituents | cyclohexenonecarbonyl groupoxosteroidandrogen-skeletonabietane diterpenoidcyclic ketonealiphatic homopolycyclic compoundketoneorganic oxideorganic oxygen compounddelta-1-steroid3-oxosteroidhydrocarbon derivativediterpenoid3-oxo-delta-1-steroidorganooxygen compound |
|---|
