| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:31 UTC |
|---|
| Update Date | 2025-03-25 00:51:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02188809 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H15N5O5 |
|---|
| Molecular Mass | 309.1073 |
|---|
| SMILES | CC(O)C(O)CC(=O)C(=O)C1=Nc2c([nH]c(N)nc2=O)NC1 |
|---|
| InChI Key | CHAGTZJDOOKOSR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsalpha-diketonesazacyclic compoundsbeta-hydroxy ketonesheteroaromatic compoundshydrocarbon derivativesketiminesorganic oxidesorganopnictogen compoundsprimary aminespropargyl-type 1,3-dipolar organic compoundspyrimidonessecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | beta-hydroxy ketoneketiminecarbonyl groupiminepyrimidonepyrimidinepropargyl-type 1,3-dipolar organic compoundketoneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound1,2-diolalcoholvinylogous amidepterinazacycleheteroaromatic compoundorganic 1,3-dipolar compoundsecondary aminealpha-diketonesecondary aliphatic/aromatic amineorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|