| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:38 UTC |
|---|
| Update Date | 2025-03-25 00:51:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02189088 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15NO4S |
|---|
| Molecular Mass | 245.0722 |
|---|
| SMILES | CC(C)CC1SC2C(O)C(=O)N2C1C(=O)O |
|---|
| InChI Key | OZJUWPMGTRXYML-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | peptidomimetics |
|---|
| Subclass | hybrid peptides |
|---|
| Direct Parent | hybrid peptides |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidsazacyclic compoundsazetidinescarbonyl compoundscarboxylic acidsdialkylthioethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspenamssecondary alcoholstertiary carboxylic acid amidesthiazolidinesthiohemiaminal derivatives |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidalpha-amino acid or derivativescarboxylic acid derivativealiphatic heteropolycyclic compoundorganic oxidetertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidhemithioaminalorganopnictogen compoundorganoheterocyclic compoundcyclic hybrid peptidealcoholazacycledialkylthioethercarboxamide groupazetidinemonocarboxylic acid or derivativespenamorganic oxygen compoundthioethersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundbeta-lactamorganooxygen compoundthiazolidine |
|---|
