| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:41 UTC |
|---|
| Update Date | 2025-03-25 00:51:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02189186 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H28N4O4 |
|---|
| Molecular Mass | 328.2111 |
|---|
| SMILES | CC(C)CC(N)C(=O)N1CCN(C(=O)CCC(N)C(=O)O)CC1 |
|---|
| InChI Key | JOZPDPYJOZFKEH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha amino acid amidesalpha amino acidsazacyclic compoundsbranched fatty acidscarbonyl compoundscarboxylic acidsheterocyclic fatty acidshydrocarbon derivativesleucine and derivativesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperazinestertiary carboxylic acid amides |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidglutamine or derivativesheterocyclic fatty acidfatty acidorganic oxidepiperazineleucine or derivativestertiary carboxylic acid amidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundalpha-amino acid amideazacyclecarboxamide groupbranched fatty acidmonocarboxylic acid or derivativesorganic oxygen compound1,4-diazinanehydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
