| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:42 UTC |
|---|
| Update Date | 2025-03-25 00:51:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02189241 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17NO6 |
|---|
| Molecular Mass | 259.1056 |
|---|
| SMILES | CC(C)CC(=O)NC(=O)CCC(C(=O)O)C(=O)O |
|---|
| InChI Key | VFSQIXLZHJBBQJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | branched fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundscarboxylic acidsdicarboximidesdicarboxylic acids and derivativeshydrocarbon derivativesn-acyl aminesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidcarboxylic acid derivativebranched fatty acidn-acyl-aminecarboxylic acid imidecarboxylic acid imide, n-unsubstitutedorganic oxideorganic oxygen compoundorganonitrogen compounddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativedicarboximideorganic nitrogen compound1,3-dicarbonyl compoundorganooxygen compound |
|---|