| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:45 UTC |
|---|
| Update Date | 2025-03-25 00:51:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02189374 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C28H48O3 |
|---|
| Molecular Mass | 432.3603 |
|---|
| SMILES | CC(CC(C)C1CCC2C3=C(CCC21C)C1(C)CCC(O)C(C)(C)C1CC3)C(O)CO |
|---|
| InChI Key | YWYBVBSBBPLLHR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | bile acids, alcohols and derivatives |
|---|
| Direct Parent | bile acids, alcohols and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 3-hydroxysteroidscyclic alcohols and derivativesditerpenoidsfatty alcoholshydrocarbon derivativesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholfatty acylabietane diterpenoid25-hydroxysteroid3-hydroxysteroidhydroxysteroidcyclic alcoholbile acid, alcohol, or derivativesaliphatic homopolycyclic compoundorganic oxygen compound24-hydroxysteroidfatty alcoholsecondary alcoholhydrocarbon derivativediterpenoidprimary alcoholorganooxygen compound |
|---|