| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:47 UTC |
|---|
| Update Date | 2025-03-25 00:51:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02189434 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16O4 |
|---|
| Molecular Mass | 260.1049 |
|---|
| SMILES | CC(C)c1ccc(OCc2ccc(C(=O)O)o2)cc1 |
|---|
| InChI Key | UUHXCKRZEMAPMU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | cumenes |
|---|
| Direct Parent | cumenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl etherscarboxylic acidsfuroic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsphenol ethersphenoxy compoundsphenylpropanes |
|---|
| Substituents | furanphenol etheretherfuroic acid or derivativescarboxylic acidaromatic heteromonocyclic compoundheteroaromatic compoundalkyl aryl ethercarboxylic acid derivativefuroic acidphenylpropaneoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcumenehydrocarbon derivativephenoxy compoundorganoheterocyclic compoundorganooxygen compound |
|---|
