| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:49 UTC |
|---|
| Update Date | 2025-03-25 00:51:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02189531 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C30H49NO4 |
|---|
| Molecular Mass | 487.3662 |
|---|
| SMILES | CC(CCC(=O)NCCCC(=O)O)C1CCC2C3=C(CCC21C)C1(C)CCC(O)C(C)(C)C1CC3 |
|---|
| InChI Key | PEKPHZRDKMAKTL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | bile acids, alcohols and derivatives |
|---|
| Direct Parent | bile acids, alcohols and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 3-hydroxysteroidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativesditerpenoidsgamma amino acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidabietane diterpenoidgamma amino acid or derivativesfatty amidecarboxylic acid derivativebile acid, alcohol, or derivativesaliphatic homopolycyclic compoundorganic oxideorganonitrogen compoundorganopnictogen compoundalcohol3-hydroxysteroidhydroxysteroidcyclic alcoholcarboxamide groupn-acyl-aminesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundditerpenoidorganooxygen compound |
|---|
