| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:51 UTC |
|---|
| Update Date | 2025-03-25 00:51:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02189607 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C34H58O7 |
|---|
| Molecular Mass | 578.4183 |
|---|
| SMILES | CC(C)CCCC(C)C1CCC2C3CCC4CC(OC5CC(C(=O)O)C(O)C(O)C5O)CCC4(C)C3C(O)CC12C |
|---|
| InChI Key | HFECBMRBHLPJGP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | steroids and steroid derivatives |
|---|
| Subclass | cholestane steroids |
|---|
| Direct Parent | cholesterols and derivatives |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | 11-hydroxysteroidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativescyclohexanolsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxides |
|---|
| Substituents | alcoholcarbonyl groupethercarboxylic acidcyclohexanolhydroxysteroidcyclitol or derivativeshydroxy acidcyclic alcoholcarboxylic acid derivativedialkyl ethercholesterolaliphatic homopolycyclic compoundbeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivative11-hydroxysteroidorganooxygen compound |
|---|