| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:53 UTC |
|---|
| Update Date | 2025-03-25 00:51:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02189650 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H19FN2O4S |
|---|
| Molecular Mass | 402.105 |
|---|
| SMILES | CC(C)c1c(C(=O)O)cc(-c2ccc(F)cc2)n1-c1ccc(S(N)(=O)=O)cc1 |
|---|
| InChI Key | VXZMNMPQTARUBR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundsaryl fluoridesazacyclic compoundsbenzenesulfonyl compoundscarboxylic acidsfluorobenzenesheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsorganosulfonamidespyrrole carboxylic acidssubstituted pyrrolesvinylogous amides |
|---|
| Substituents | aryl fluorideorganosulfonic acid or derivativescarboxylic acidaromatic heteromonocyclic compoundpyrrole-3-carboxylic acid or derivativessubstituted pyrroleorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amidefluorobenzeneorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundbenzenesulfonyl groupvinylogous amidebenzenesulfonamideazacycleaminosulfonyl compoundorganofluorideheteroaromatic compoundaryl halidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativespyrrolehydrocarbon derivativeorganic nitrogen compoundhalobenzenepyrrole-3-carboxylic acidorganooxygen compound |
|---|