| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:53 UTC |
|---|
| Update Date | 2025-03-25 00:51:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02189674 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H29NO3 |
|---|
| Molecular Mass | 331.2147 |
|---|
| SMILES | CC(C)Cc1ccc(C(O)C(=O)OC2CC3CCC(C2)N3C)cc1 |
|---|
| InChI Key | HXXOJAYSQYDKBP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | tropane alkaloids |
|---|
| Subclass | tropane alkaloids |
|---|
| Direct Parent | tropane alkaloids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundsphenylpropanespiperidinessecondary alcoholstrialkylamines |
|---|
| Substituents | aromatic alcoholmonocyclic benzene moietycarbonyl groupamino acid or derivativescarboxylic acid derivativephenylpropaneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidinepiperidinetertiary amineorganoheterocyclic compoundalcoholazacyclen-alkylpyrrolidinetertiary aliphatic aminemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundtropane alkaloidamineorganooxygen compound |
|---|