| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:54:55 UTC |
|---|
| Update Date | 2025-03-25 00:51:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02189753 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H14O7 |
|---|
| Molecular Mass | 234.074 |
|---|
| SMILES | C=CCOC(=O)C(O)C(O)C(O)C(O)C=O |
|---|
| InChI Key | YQUWEXFYFCGYRA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxyaldehydesbeta hydroxy acids and derivativesbeta-hydroxy aldehydescarboxylic acid estersfatty acid estershydrocarbon derivativesmedium-chain aldehydesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholfatty acylaliphatic acyclic compoundbeta-hydroxy aldehydecarbonyl groupglucuronic acid or derivativesmonosaccharidealdehydehydroxy acidcarboxylic acid derivativemedium-chain aldehydefatty acid esterbeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesalpha-hydroxyaldehydecarboxylic acid estersecondary alcoholhydrocarbon derivative |
|---|
