| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:07 UTC |
|---|
| Update Date | 2025-03-25 00:51:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190178 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10N2O4S |
|---|
| Molecular Mass | 230.0361 |
|---|
| SMILES | CC(=O)NC(=O)C1CSCC(C(=O)O)=N1 |
|---|
| InChI Key | DRORSPOCBBFBMA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylthioethersdicarboximideshydrocarbon derivativesketiminesmonocarboxylic acids and derivativesn-unsubstituted carboxylic acid imidesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | ketiminecarbonyl groupcarboxylic acidiminepropargyl-type 1,3-dipolar organic compoundcarboxylic acid imide, n-unsubstitutedorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compounddicarboximideorganoheterocyclic compoundacetamideazacycledialkylthioetherorganic 1,3-dipolar compoundcarboxylic acid imidemonocarboxylic acid or derivativesorganic oxygen compoundthioetherhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
