| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:07 UTC |
|---|
| Update Date | 2025-03-25 00:51:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190181 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10ClNO3 |
|---|
| Molecular Mass | 227.0349 |
|---|
| SMILES | CC(=O)NC(=O)Cc1ccc(O)c(Cl)c1 |
|---|
| InChI Key | NLWFKBFRCTVJFK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetamidesaryl chloridescarbonyl compoundscarboxylic acids and derivativeschlorobenzenesdicarboximideshalophenolshydrocarbon derivativesn-unsubstituted carboxylic acid imideso-chlorophenolsorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | carbonyl grouporganochloride1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganohalogen compoundcarboxylic acid imide, n-unsubstitutedorganic oxideorganonitrogen compoundorganopnictogen compounddicarboximidephenylacetamideacetamidearyl chloride2-chlorophenolchlorobenzenearyl halidecarboxylic acid imidearomatic homomonocyclic compound2-halophenolorganic oxygen compoundphenolhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
