| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:08 UTC |
|---|
| Update Date | 2025-03-25 00:51:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190224 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H15NO5 |
|---|
| Molecular Mass | 301.095 |
|---|
| SMILES | CC(=O)NC(CC(=O)c1ccc2ccccc2c1O)C(=O)O |
|---|
| InChI Key | WUFKRSQRJJRNKT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | n-acyl-alpha amino acids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-4-unsubstituted benzenoidsacetamidesalpha amino acidsaryl alkyl ketonesbutyrophenonescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthols and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidesvinylogous acids |
|---|
| Substituents | carbonyl groupcarboxylic acidaryl alkyl ketoneketoneorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundacetamiden-acyl-alpha-amino acidaromatic homopolycyclic compound1-hydroxy-4-unsubstituted benzenoidcarboxamide groupgamma-keto acidbutyrophenonesecondary carboxylic acid amidevinylogous acidmonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundketo acidhydrocarbon derivative1-naphtholbenzenoidorganic nitrogen compoundorganooxygen compoundaryl ketone |
|---|
