| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:10 UTC |
|---|
| Update Date | 2025-03-25 00:51:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190278 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H28Cl2N2O4 |
|---|
| Molecular Mass | 478.1426 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(OCC3CC(C)C(O)(c4ccc(Cl)cc4Cl)O3)cc2)CC1 |
|---|
| InChI Key | NQXCITKBOHDLSA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazinanes |
|---|
| Subclass | piperazines |
|---|
| Direct Parent | phenylpiperazines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersamino acids and derivativesaminophenyl ethersaniline and substituted anilinesaryl chloridesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylarylaminesdichlorobenzeneshemiacetalshydrocarbon derivativesn-arylpiperazinesorganic oxidesorganochloridesorganopnictogen compoundsoxacyclic compoundsphenoxy compoundstertiary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundamino acid or derivativesorganochloridealkyl aryl ethercarboxylic acid derivativeorganohalogen compound1,3-dichlorobenzeneorganic oxidetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundhemiacetaldialkylarylamineaminophenyl ethertertiary amineacetamidearyl chloridechlorobenzeneazacycletetrahydrofurananiline or substituted anilinescarboxamide grouparyl halidephenylpiperazineoxacycleorganic oxygen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzenephenoxy compoundaminen-arylpiperazineorganooxygen compound |
|---|
