| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:11 UTC |
|---|
| Update Date | 2025-03-25 00:51:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190309 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O2 |
|---|
| Molecular Mass | 250.0994 |
|---|
| SMILES | CC(=O)C(=Cc1ccccc1)C(=O)c1ccccc1 |
|---|
| InChI Key | HBHTVGRYGXGEFG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | linear 1,3-diarylpropanoids |
|---|
| Direct Parent | linear 1,3-diarylpropanoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acryloyl compoundsalpha-branched alpha,beta-unsaturated ketonesaryl ketonesbenzoyl derivativesbutyrophenonescinnamic acids and derivativesenoneshydrocarbon derivativesorganic oxides |
|---|
| Substituents | alpha-branched alpha,beta-unsaturated-ketonelinear 1,3-diarylpropanoidmonocyclic benzene moietycarbonyl groupbenzoylalpha,beta-unsaturated ketoneketonebutyrophenonearomatic homomonocyclic compoundcinnamic acid or derivativesorganic oxideorganic oxygen compoundhydrocarbon derivativebenzenoidacryloyl-grouporganooxygen compoundaryl ketoneenone |
|---|