| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:13 UTC |
|---|
| Update Date | 2025-03-25 00:51:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190409 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H16O6 |
|---|
| Molecular Mass | 316.0947 |
|---|
| SMILES | CC(=O)C1Cc2cc(O)cc(O)c2OC1c1ccc(O)c(O)c1 |
|---|
| InChI Key | CLVLBVNEOXVCDA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 8-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids4'-hydroxyflavonoids6-hydroxyflavonoidsalkyl aryl ethersbenzene and substituted derivativesflavanshydrocarbon derivativesketonesorganic oxidesoxacyclic compounds |
|---|
| Substituents | 8-hydroxyflavonoidmonocyclic benzene moietycarbonyl groupether1-benzopyranflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherketoneorganic oxidearomatic heteropolycyclic compoundchromaneorganoheterocyclic compoundbenzopyran6-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacycleorganic oxygen compound4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|