Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-21 14:55:14 UTC |
---|
Update Date | 2025-03-25 00:51:56 UTC |
---|
HMDB ID | HMDB0135680 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02190421 |
---|
Name | 3,4,5-trihydroxy-6-[2-hydroxy-5-(3-oxobut-1-en-1-yl)phenoxy]oxane-2-carboxylic acid |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C16H18O9 |
---|
Molecular Mass | 354.0951 |
---|
SMILES | CC(=O)C=Cc1ccc(O)c(OC2OC(C(=O)O)C(O)C(O)C2O)c1 |
---|
InChI Key | OHAINUUMXLQGNH-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | o-glucuronides |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsacryloyl compoundsbeta hydroxy acids and derivativescarboxylic acidsenonesglucuronic acid derivativeshydrocarbon derivativeshydroxycinnamic acidsketonesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcohols |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundo-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidealpha,beta-unsaturated ketonecarboxylic acid derivativepyran carboxylic acidhydroxycinnamic acid or derivativesketone1-o-glucuronidecinnamic acid or derivativesbeta-hydroxy acidorganic oxideacetaloxaneorganoheterocyclic compoundenonealcoholpyran carboxylic acid or derivativeshydroxy acidhydroxycinnamic acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholphenolhydrocarbon derivativebenzenoidacryloyl-groupphenoxy compound |
---|