| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:14 UTC |
|---|
| Update Date | 2025-03-25 00:51:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190436 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16O |
|---|
| Molecular Mass | 200.1201 |
|---|
| SMILES | CC(=O)C1=C(C)Cc2cc(C)c(C)cc21 |
|---|
| InChI Key | GXNKJGDCFPKKDJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | indenes and isoindenes |
|---|
| Subclass | indenes and isoindenes |
|---|
| Direct Parent | indenes and isoindenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesketonesorganic oxides |
|---|
| Substituents | ketonecarbonyl grouporganic oxideindeneorganic oxygen compoundaromatic homopolycyclic compoundhydrocarbon derivativeorganooxygen compound |
|---|
