| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:15 UTC |
|---|
| Update Date | 2025-03-25 00:51:56 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190462 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H21NO6 |
|---|
| Molecular Mass | 335.1369 |
|---|
| SMILES | CC(=O)C1CCC(=O)N1C(=O)CCC(O)Cc1ccc(O)c(O)c1 |
|---|
| InChI Key | RJUMKPVPDLJIFY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrrolidines |
|---|
| Subclass | n-acylpyrrolidines |
|---|
| Direct Parent | n-acylpyrrolidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativescarboxylic acids and derivativesdicarboximideshydrocarbon derivativesketonesn-substituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolidine-2-onessecondary alcohols |
|---|
| Substituents | 2-pyrrolidonemonocyclic benzene moietycarbonyl grouparomatic heteromonocyclic compoundn-acylpyrrolidine1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeketoneorganic oxideorganonitrogen compoundorganopnictogen compounddicarboximidecarboxylic acid imide, n-substitutedpyrrolidonealcoholazacycle1-hydroxy-4-unsubstituted benzenoidcarboxylic acid imideorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
