| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:16 UTC |
|---|
| Update Date | 2025-03-25 00:51:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190498 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H27NO2 |
|---|
| Molecular Mass | 289.2042 |
|---|
| SMILES | C=C1CCC(O)(C(CN(C)C)c2ccc(OC)cc2)CC1 |
|---|
| InChI Key | BYIDDNURZXAAAI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | aromatic monoterpenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1,3-aminoalcoholsalkyl aryl ethersanisolescyclic alcohols and derivativeshydrocarbon derivativesmenthane monoterpenoidsmethoxybenzenesmonocyclic monoterpenoidsorganopnictogen compoundsphenoxy compoundstertiary alcoholstrialkylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietymonocyclic monoterpenoidetheralkyl aryl etherorganonitrogen compoundorganopnictogen compoundtertiary aminealcohol1,3-aminoalcoholtertiary aliphatic aminecyclic alcoholmethoxybenzenep-menthane monoterpenoidaromatic homomonocyclic compoundtertiary alcoholorganic oxygen compoundanisolehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundamineorganooxygen compoundaromatic monoterpenoid |
|---|
