| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:17 UTC |
|---|
| Update Date | 2025-03-25 00:51:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190531 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C2H4O7S2 |
|---|
| Molecular Mass | 203.9398 |
|---|
| SMILES | C=C(OS(=O)(=O)O)S(=O)(=O)O |
|---|
| InChI Key | DNQLCEMJHLKHFE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | sulfuric acid esters |
|---|
| Direct Parent | sulfuric acid monoesters |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganic oxidesorganooxygen compoundsorganosulfonic acidssulfonyls |
|---|
| Substituents | aliphatic acyclic compoundorganosulfonic acid or derivativessulfuric acid monoesterorganosulfonic acidorganosulfur compoundorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativessulfate-esterhydrocarbon derivativeorganooxygen compound |
|---|
