| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:25 UTC |
|---|
| Update Date | 2025-03-25 00:52:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190818 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H20O7 |
|---|
| Molecular Mass | 324.1209 |
|---|
| SMILES | C=C(C)c1ccc(OC2C(O)C(O)C(O)C(O)C2C(=O)O)cc1 |
|---|
| InChI Key | QFBZBIPZNYDPEB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpropenes |
|---|
| Direct Parent | phenylpropenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidscyclitols and derivativescyclohexanolshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenol ethersphenoxy compounds |
|---|
| Substituents | alcoholphenol ethercarbonyl groupethercarboxylic acidcyclohexanolcyclitol or derivativeshydroxy acidcyclic alcoholalkyl aryl ethercarboxylic acid derivativearomatic homomonocyclic compoundbeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenylpropenesecondary alcoholhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
