| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:26 UTC |
|---|
| Update Date | 2025-03-25 00:52:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190845 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C33H40N4O7 |
|---|
| Molecular Mass | 604.2897 |
|---|
| SMILES | C=CC1=C(C)C(=O)NC1=Cc1[nH]c(Cc2[nH]c(CC3NC(=O)C(CC)=C3C)c(C)c2CC(O)C(=O)O)c(CCC(=O)O)c1C |
|---|
| InChI Key | KPQKPXKWEJZEGF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | tetrapyrroles and derivatives |
|---|
| Subclass | bilirubins |
|---|
| Direct Parent | bilirubins |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeslactamsmetallotetrapyrrolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrrolespyrrolinessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamcarboxylic acidaromatic heteromonocyclic compoundalpha-hydroxy acidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundmetallotetrapyrrole skeletonalcoholazacycleheteroaromatic compoundhydroxy acidcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundpyrrolinebilirubin skeletonpyrrolesecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|