| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:29 UTC |
|---|
| Update Date | 2025-03-25 00:52:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02190970 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H18O |
|---|
| Molecular Mass | 214.1358 |
|---|
| SMILES | C=CC1=C(C)C(Cc2ccc(O)cc2)CC1 |
|---|
| InChI Key | KRZRHRAQJXJLBA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | iridoids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaromatic monoterpenoidsbenzene and substituted derivativeshydrocarbon derivativesmonocyclic monoterpenoidsorganooxygen compounds |
|---|
| Substituents | monocyclic benzene moietymonocyclic monoterpenoid1-hydroxy-2-unsubstituted benzenoidaromatic homomonocyclic compoundorganic oxygen compoundphenolhydrocarbon derivativebenzenoid11-noriridane monoterpenoidorganooxygen compoundaromatic monoterpenoid |
|---|
