| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:33 UTC |
|---|
| Update Date | 2025-03-25 00:52:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02191105 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H37NO4 |
|---|
| Molecular Mass | 391.2723 |
|---|
| SMILES | C=CC1(O)CCC2C3CCC(C(C)CCC(=O)NCC(=O)O)C3(C)CCC21C |
|---|
| InChI Key | BOVOBFNCXOPODE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary carboxylic acid amidessesquiterpenoidstertiary alcohols |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidfatty amidealiphatic homopolycyclic compoundorganic oxidesesquiterpenoidorganonitrogen compoundalpha-amino acidorganopnictogen compoundalcoholcyclic alcoholcarboxamide groupn-acyl-aminen-acylglycinesecondary carboxylic acid amidetertiary alcoholmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
