| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:34 UTC |
|---|
| Update Date | 2025-03-25 00:52:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02191142 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H27N3O12 |
|---|
| Molecular Mass | 465.1595 |
|---|
| SMILES | CC(=O)NC1C(OC(=O)C(CC(=O)O)NC(=O)CCC(N)C(=O)O)OC(CO)C(O)C1O |
|---|
| InChI Key | BEOLZYBPJJZPPK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha-amino acyl ester of carbohydrates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalpha amino acidsaspartic acid and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsfatty acid estersfatty acyl glycosides of mono- and disaccharidesglutamine and derivativeshydrocarbon derivativesmonoalkylaminesmonosaccharidesn-acyl aminesn-acyl-alpha amino acidsn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amidestricarboxylic acids and derivatives |
|---|
| Substituents | fatty acylfatty acyl glycoside of mono- or disaccharidecarbonyl groupcarboxylic acidglutamine or derivativesfatty amidemonosaccharidetricarboxylic acid or derivativesn-acyl-alpha-hexosaminesaccharideorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamiden-acyl-alpha amino acid or derivativesalcoholfatty acyl glycosiden-acyl-alpha-amino acidcarboxamide groupn-acyl-amineoxacyclesecondary carboxylic acid amidefatty acid esterorganic oxygen compoundcarboxylic acid esteralpha-amino acyl ester of carbohydrateaspartic acid or derivativessecondary alcoholhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|