| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:38 UTC |
|---|
| Update Date | 2025-03-25 00:52:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02191284 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H21NO11S |
|---|
| Molecular Mass | 387.0835 |
|---|
| SMILES | CC(=O)NC1C(O)OC(COS(=O)(=O)O)C(O)C1OCCCC(=O)O |
|---|
| InChI Key | WEDPDANAHFJPCP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl sulfatescarbonyl compoundscarboxylic acidsdialkyl ethershemiacetalsheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsmonocarboxylic acids and derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessaccharolipidssecondary alcoholssecondary carboxylic acid amidesshort-chain hydroxy acids and derivativessulfated fatty acidssulfuric acid monoesters |
|---|
| Substituents | fatty acylsulfuric acid monoestercarbonyl groupethercarboxylic acidshort-chain hydroxy acidheterocyclic fatty acidmonosaccharidefatty acidcarboxylic acid derivativedialkyl ethern-acyl-alpha-hexosamineorganic oxidealkyl sulfatealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalhydroxy fatty acidoxaneorganoheterocyclic compoundacetamidealcoholorganic sulfuric acid or derivativescarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativessulfated fatty acidsecondary alcoholsulfate-esterhydrocarbon derivativeorganic nitrogen compoundsulfuric acid estersaccharolipid |
|---|
