| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:55:51 UTC |
|---|
| Update Date | 2025-03-25 00:52:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02191772 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17NO8 |
|---|
| Molecular Mass | 291.0954 |
|---|
| SMILES | CC(=O)NC1C(CC(=O)C(=O)O)OC(CO)C(O)C1O |
|---|
| InChI Key | VSELSKPNZNRYFH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | monosaccharides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesalpha-hydroxy ketonesalpha-keto acids and derivativescarboxylic acidsdialkyl ethershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupethercarboxylic acidmonosaccharidealpha-hydroxy ketonecarboxylic acid derivativedialkyl etherketoneorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-keto acidorganopnictogen compoundoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholcarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesketo acidsecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|
