Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:55:55 UTC |
---|
Update Date | 2025-03-25 00:52:10 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02191953 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C19H22N2O10 |
---|
Molecular Mass | 438.1274 |
---|
SMILES | CC(=O)NC1C(O)CC(O)(C(=O)O)CC1OC(=O)CNC(=O)c1ccccc1C(=O)O |
---|
InChI Key | QPUZFCPNGATHTQ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | acyl glycines |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-carboxy-2-haloaromatic compoundsacetamidesalpha amino acid estersalpha amino acidsalpha hydroxy acids and derivativesbenzoic acidsbenzoyl derivativescarbonyl compoundscarboxylic acid esterscyclohexanolshippuric acids and derivativeshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsquinic acids and derivativessecondary carboxylic acid amidestertiary alcoholstricarboxylic acids and derivatives |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidalpha-hydroxy acidbenzoyltricarboxylic acid or derivativesbenzamideorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidacetamidealcoholalpha-amino acid esterhippuric acid or derivativescyclohexanolbenzoic acid or derivativescyclitol or derivativeshydroxy acidcyclic alcoholcarboxamide groupn-acylglycinearomatic homomonocyclic compoundsecondary carboxylic acid amidetertiary alcoholorganic oxygen compoundcarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundquinic acid |
---|