| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:02 UTC |
|---|
| Update Date | 2025-03-25 00:52:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02192173 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H34O3 |
|---|
| Molecular Mass | 322.2508 |
|---|
| SMILES | CCCCCCCCC(C)C(CO)Cc1ccc(O)c(OC)c1 |
|---|
| InChI Key | CBCVOXVAWPUBMY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | methoxyphenols |
|---|
| Direct Parent | methoxyphenols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesfatty alcoholshydrocarbon derivativesmethoxybenzenesphenoxy compoundsprimary alcohols |
|---|
| Substituents | alcoholfatty acylphenol ethermonocyclic benzene moietyether1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl ethermethoxybenzenearomatic homomonocyclic compoundorganic oxygen compoundfatty alcoholanisolehydrocarbon derivativephenoxy compoundprimary alcoholorganooxygen compound |
|---|