| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:56:03 UTC |
|---|
| Update Date | 2025-03-25 00:52:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02192215 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C36H70N2O6P+ |
|---|
| Molecular Mass | 657.4966 |
|---|
| SMILES | CCCCCCCC=CCCCCCCCC(=O)NC(COP(=O)(O)OCC[N+](C)(C)C)C(=O)C=CCCCCCCCCC |
|---|
| InChI Key | BCDSOAGTGAJJEW-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | quaternary ammonium salts |
|---|
| Direct Parent | phosphocholines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acryloyl compoundsaminescarboxylic acids and derivativesdialkyl phosphatesenoneshydrocarbon derivativesketonesn-acyl aminesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundsphosphoethanolaminessecondary carboxylic acid amidestetraalkylammonium salts |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupfatty amidealpha,beta-unsaturated ketonecarboxylic acid derivativeketonephosphoethanolamineorganic oxideorganopnictogen compoundorganic cationorganic saltenonetetraalkylammonium saltcarboxamide groupn-acyl-aminephosphocholinesecondary carboxylic acid amidedialkyl phosphateorganic oxygen compoundphosphoric acid esterhydrocarbon derivativeacryloyl-grouporganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|